C19H22O8S — CID 101232217
1,7-bis(3,4-dihydroxyphenyl)-5-oxoheptane-3-sulfonic acid (PubChem CID 101232217) has the molecular formula C19H22O8S and a molecular weight of 410.44 g/mol. Its IUPAC name is 1,7-bis(3,4-dihydroxyphenyl)-5-oxoheptane-3-sulfonic acid.
| Compound Name | 1,7-bis(3,4-dihydroxyphenyl)-5-oxoheptane-3-sulfonic acid |
|---|---|
| PubChem CID | 101232217 |
| Molecular Formula | C19H22O8S |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 1,7-bis(3,4-dihydroxyphenyl)-5-oxoheptane-3-sulfonic acid |
| SMILES | O=C(CCc1ccc(O)c(O)c1)CC(CCc1ccc(O)c(O)c1)S(=O)(=O)O |
| InChI | InChI=1S/C19H22O8S/c20-14(5-1-12-3-7-16(21)18(23)9-12)11-15(28(25,26)27)6-2-13-4-8-17(22)19(24)10-13/h3-4,7-10,15,21-24H,1-2,5-6,11H2,(H,25,26,27) |
| InChIKey | IMDXRLLSWYZMEN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|