C15H22O6S — CID 162849811
(4S)-8-(4-hydroxy-3-methoxyphenyl)-6-oxooctane-4-sulfonic acid (PubChem CID 162849811) has the molecular formula C15H22O6S and a molecular weight of 330.40 g/mol. Its IUPAC name is (4S)-8-(4-hydroxy-3-methoxyphenyl)-6-oxooctane-4-sulfonic acid.
| Compound Name | (4S)-8-(4-hydroxy-3-methoxyphenyl)-6-oxooctane-4-sulfonic acid |
|---|---|
| PubChem CID | 162849811 |
| Molecular Formula | C15H22O6S |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | (4S)-8-(4-hydroxy-3-methoxyphenyl)-6-oxooctane-4-sulfonic acid |
| SMILES | CCC[C@@H](CC(=O)CCc1ccc(O)c(OC)c1)S(=O)(=O)O |
| InChI | InChI=1S/C15H22O6S/c1-3-4-13(22(18,19)20)10-12(16)7-5-11-6-8-14(17)15(9-11)21-2/h6,8-9,13,17H,3-5,7,10H2,1-2H3,(H,18,19,20)/t13-/m0/s1 |
| InChIKey | YJMGVBJYAHWWPU-ZDUSSCGKSA-N |
| XLogP | 2.35 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|