C17H27NO4 — CID 162955116
1-(4-hydroxy-3-methoxyphenyl)-5-(methylaminomethoxy)octan-3-one (PubChem CID 162955116) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-(4-hydroxy-3-methoxyphenyl)-5-(methylaminomethoxy)octan-3-one.
| Compound Name | 1-(4-hydroxy-3-methoxyphenyl)-5-(methylaminomethoxy)octan-3-one |
|---|---|
| PubChem CID | 162955116 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 1-(4-hydroxy-3-methoxyphenyl)-5-(methylaminomethoxy)octan-3-one |
| SMILES | CCCC(CC(=O)CCc1ccc(O)c(OC)c1)OCNC |
| InChI | InChI=1S/C17H27NO4/c1-4-5-15(22-12-18-2)11-14(19)8-6-13-7-9-16(20)17(10-13)21-3/h7,9-10,15,18,20H,4-6,8,11-12H2,1-3H3 |
| InChIKey | WZHUVGMMRDZBCN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|