C24H30O9 — CID 44608367
(5S)-1,7-bis(4-hydroxyphenyl)-5-[(2S,3S,4R,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]oxyheptan-3-one (PubChem CID 44608367) has the molecular formula C24H30O9 and a molecular weight of 462.50 g/mol. Its IUPAC name is (5S)-1,7-bis(4-hydroxyphenyl)-5-[(2S,3S,4R,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]oxyheptan-3-one.
| Compound Name | (5S)-1,7-bis(4-hydroxyphenyl)-5-[(2S,3S,4R,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]oxyheptan-3-one |
|---|---|
| PubChem CID | 44608367 |
| Molecular Formula | C24H30O9 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | (5S)-1,7-bis(4-hydroxyphenyl)-5-[(2S,3S,4R,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]oxyheptan-3-one |
| SMILES | O=C(CCc1ccc(O)cc1)C[C@H](CCc1ccc(O)cc1)O[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H30O9/c25-16-7-1-14(2-8-16)5-11-18(27)13-19(12-6-15-3-9-17(26)10-4-15)32-24-22(30)20(28)21(29)23(31)33-24/h1-4,7-10,19-26,28-31H,5-6,11-13H2/t19-,20+,21+,22-,23+,24-/m0/s1 |
| InChIKey | GGKOOZHSHJBCOM-GMKBEQEGSA-N |
| XLogP | 0.76 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |