C34H38O11 — CID 162858459
[(2R,3S,4S,5R,6S)-6-[(3S)-1,7-bis(4-hydroxyphenyl)-5-oxoheptan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 162858459) has the molecular formula C34H38O11 and a molecular weight of 622.67 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-[(3S)-1,7-bis(4-hydroxyphenyl)-5-oxoheptan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-[(3S)-1,7-bis(4-hydroxyphenyl)-5-oxoheptan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162858459 |
| Molecular Formula | C34H38O11 |
| Molecular Weight | 622.67 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[(3S)-1,7-bis(4-hydroxyphenyl)-5-oxoheptan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | O=C(CCc1ccc(O)cc1)C[C@H](CCc1ccc(O)cc1)O[C@H]1O[C@H](COC(=O)C=Cc2ccc(O)cc2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C34H38O11/c35-24-10-1-21(2-11-24)7-16-27(38)19-28(17-8-22-3-12-25(36)13-4-22)44-34-33(42)32(41)31(40)29(45-34)20-43-30(39)18-9-23-5-14-26(37)15-6-23/h1-6,9-15,18,28-29,31-37,40-42H,7-8,16-17,19-20H2/t28-,29+,31+,32-,33+,34-/m0/s1 |
| InChIKey | MHWAHKIDOYBXCN-ZXQPRKNFSA-N |
| XLogP | 2.78 |
| TPSA | 183.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.67 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|