C12H17ClO6 — CID 56613923
3-chloro-1,4-dimethoxy-2,5-bis(methoxymethoxy)benzene (PubChem CID 56613923) has the molecular formula C12H17ClO6 and a molecular weight of 292.72 g/mol. Its IUPAC name is 3-chloro-1,4-dimethoxy-2,5-bis(methoxymethoxy)benzene.
| Compound Name | 3-chloro-1,4-dimethoxy-2,5-bis(methoxymethoxy)benzene |
|---|---|
| PubChem CID | 56613923 |
| Molecular Formula | C12H17ClO6 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 3-chloro-1,4-dimethoxy-2,5-bis(methoxymethoxy)benzene |
| SMILES | COCOc1cc(OC)c(OCOC)c(Cl)c1OC |
| InChI | InChI=1S/C12H17ClO6/c1-14-6-18-9-5-8(16-3)12(19-7-15-2)10(13)11(9)17-4/h5H,6-7H2,1-4H3 |
| InChIKey | UCVZGLREXNDZID-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|