C38H58O12 — CID 19757153
1-[5-[2,5-dimethoxy-3,6-bis(methoxymethoxy)phenyl]pentyl]-2,5-dimethoxy-3,6-bis(methoxymethoxy)-4-non-4-ynylbenzene (PubChem CID 19757153) has the molecular formula C38H58O12 and a molecular weight of 706.87 g/mol. Its IUPAC name is 1-[5-[2,5-dimethoxy-3,6-bis(methoxymethoxy)phenyl]pentyl]-2,5-dimethoxy-3,6-bis(methoxymethoxy)-4-non-4-ynylbenzene.
| Compound Name | 1-[5-[2,5-dimethoxy-3,6-bis(methoxymethoxy)phenyl]pentyl]-2,5-dimethoxy-3,6-bis(methoxymethoxy)-4-non-4-ynylbenzene |
|---|---|
| PubChem CID | 19757153 |
| Molecular Formula | C38H58O12 |
| Molecular Weight | 706.87 g/mol |
| Exact Mass | 706.39 |
| IUPAC Name | 1-[5-[2,5-dimethoxy-3,6-bis(methoxymethoxy)phenyl]pentyl]-2,5-dimethoxy-3,6-bis(methoxymethoxy)-4-non-4-ynylbenzene |
| SMILES | CCCCC#CCCCc1c(OC)c(OCOC)c(CCCCCc2c(OC)c(OCOC)cc(OC)c2OCOC)c(OC)c1OCOC |
| InChI | InChI=1S/C38H58O12/c1-10-11-12-13-14-15-17-21-29-35(45-8)38(50-27-42-5)30(36(46-9)37(29)49-26-41-4)22-19-16-18-20-28-33(44-7)32(47-24-39-2)23-31(43-6)34(28)48-25-40-3/h23H,10-12,15-22,24-27H2,1-9H3 |
| InChIKey | SNTHWLJTRIZNLC-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.87 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|