C15H23IO7 — CID 54315298
3-(3-iodopropoxy)-1,4-dimethoxy-2,5-bis(methoxymethoxy)benzene (PubChem CID 54315298) has the molecular formula C15H23IO7 and a molecular weight of 442.25 g/mol. Its IUPAC name is 3-(3-iodopropoxy)-1,4-dimethoxy-2,5-bis(methoxymethoxy)benzene.
| Compound Name | 3-(3-iodopropoxy)-1,4-dimethoxy-2,5-bis(methoxymethoxy)benzene |
|---|---|
| PubChem CID | 54315298 |
| Molecular Formula | C15H23IO7 |
| Molecular Weight | 442.25 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 3-(3-iodopropoxy)-1,4-dimethoxy-2,5-bis(methoxymethoxy)benzene |
| SMILES | COCOc1cc(OC)c(OCOC)c(OCCCI)c1OC |
| InChI | InChI=1S/C15H23IO7/c1-17-9-22-12-8-11(19-3)14(23-10-18-2)15(13(12)20-4)21-7-5-6-16/h8H,5-7,9-10H2,1-4H3 |
| InChIKey | SNSREALTROELKC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|