C13H21NO4 — CID 65364643
1-[3,5-dimethoxy-4-(methoxymethoxy)phenyl]propan-2-amine (PubChem CID 65364643) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is 1-[3,5-dimethoxy-4-(methoxymethoxy)phenyl]propan-2-amine.
| Compound Name | 1-[3,5-dimethoxy-4-(methoxymethoxy)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 65364643 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 1-[3,5-dimethoxy-4-(methoxymethoxy)phenyl]propan-2-amine |
| SMILES | COCOc1c(OC)cc(CC(C)N)cc1OC |
| InChI | InChI=1S/C13H21NO4/c1-9(14)5-10-6-11(16-3)13(18-8-15-2)12(7-10)17-4/h6-7,9H,5,8,14H2,1-4H3 |
| InChIKey | PVOMUSYJCAHQER-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|