C12H20NO3P — CID 168931516
1-(3,4-dimethoxy-5-methylphosphanyloxyphenyl)propan-2-amine (PubChem CID 168931516) has the molecular formula C12H20NO3P and a molecular weight of 257.27 g/mol. Its IUPAC name is 1-(3,4-dimethoxy-5-methylphosphanyloxyphenyl)propan-2-amine.
| Compound Name | 1-(3,4-dimethoxy-5-methylphosphanyloxyphenyl)propan-2-amine |
|---|---|
| PubChem CID | 168931516 |
| Molecular Formula | C12H20NO3P |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 1-(3,4-dimethoxy-5-methylphosphanyloxyphenyl)propan-2-amine |
| SMILES | COc1cc(CC(C)N)cc(OPC)c1OC |
| InChI | InChI=1S/C12H20NO3P/c1-8(13)5-9-6-10(14-2)12(15-3)11(7-9)16-17-4/h6-8,17H,5,13H2,1-4H3 |
| InChIKey | FQKLHZYXWRZWDQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|