C19H26ClNO6 — CID 140603503
4-[1-hydroxy-2-[2-(3,4,5-trimethoxyphenyl)ethylamino]ethyl]benzene-1,3-diol;hydrochloride (PubChem CID 140603503) has the molecular formula C19H26ClNO6 and a molecular weight of 399.87 g/mol. Its IUPAC name is 4-[1-hydroxy-2-[2-(3,4,5-trimethoxyphenyl)ethylamino]ethyl]benzene-1,3-diol;hydrochloride.
| Compound Name | 4-[1-hydroxy-2-[2-(3,4,5-trimethoxyphenyl)ethylamino]ethyl]benzene-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 140603503 |
| Molecular Formula | C19H26ClNO6 |
| Molecular Weight | 399.87 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 4-[1-hydroxy-2-[2-(3,4,5-trimethoxyphenyl)ethylamino]ethyl]benzene-1,3-diol;hydrochloride |
| SMILES | COc1cc(CCNCC(O)c2ccc(O)cc2O)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C19H25NO6.ClH/c1-24-17-8-12(9-18(25-2)19(17)26-3)6-7-20-11-16(23)14-5-4-13(21)10-15(14)22;/h4-5,8-10,16,20-23H,6-7,11H2,1-3H3;1H |
| InChIKey | SRNVWUYOQBSKEP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.87 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|