C25H30ClNO4 — CID 6366653
4-[3-[2-(2,3-dimethoxyphenyl)ethylamino]-1-phenylpropyl]benzene-1,3-diol;hydrochloride (PubChem CID 6366653) has the molecular formula C25H30ClNO4 and a molecular weight of 443.97 g/mol. Its IUPAC name is 4-[3-[2-(2,3-dimethoxyphenyl)ethylamino]-1-phenylpropyl]benzene-1,3-diol;hydrochloride.
| Compound Name | 4-[3-[2-(2,3-dimethoxyphenyl)ethylamino]-1-phenylpropyl]benzene-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 6366653 |
| Molecular Formula | C25H30ClNO4 |
| Molecular Weight | 443.97 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 4-[3-[2-(2,3-dimethoxyphenyl)ethylamino]-1-phenylpropyl]benzene-1,3-diol;hydrochloride |
| SMILES | COc1cccc(CCNCCC(c2ccccc2)c2ccc(O)cc2O)c1OC.Cl |
| InChI | InChI=1S/C25H29NO4.ClH/c1-29-24-10-6-9-19(25(24)30-2)13-15-26-16-14-21(18-7-4-3-5-8-18)22-12-11-20(27)17-23(22)28;/h3-12,17,21,26-28H,13-16H2,1-2H3;1H |
| InChIKey | NJMVAGLRMIYUGD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.97 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|