C12H19NO3S — CID 115228320
[2-(3,4,5-trimethoxyphenyl)ethylamino]methanethiol (PubChem CID 115228320) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is [2-(3,4,5-trimethoxyphenyl)ethylamino]methanethiol.
| Compound Name | [2-(3,4,5-trimethoxyphenyl)ethylamino]methanethiol |
|---|---|
| PubChem CID | 115228320 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | [2-(3,4,5-trimethoxyphenyl)ethylamino]methanethiol |
| SMILES | COc1cc(CCNCS)cc(OC)c1OC |
| InChI | InChI=1S/C12H19NO3S/c1-14-10-6-9(4-5-13-8-17)7-11(15-2)12(10)16-3/h6-7,13,17H,4-5,8H2,1-3H3 |
| InChIKey | FOINBPXLYQEVEN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|