C11H18N2O5S — CID 71658869
1,2,3-trimethoxy-5-[2-(sulfamoylamino)ethyl]benzene (PubChem CID 71658869) has the molecular formula C11H18N2O5S and a molecular weight of 290.34 g/mol. Its IUPAC name is 1,2,3-trimethoxy-5-[2-(sulfamoylamino)ethyl]benzene.
| Compound Name | 1,2,3-trimethoxy-5-[2-(sulfamoylamino)ethyl]benzene |
|---|---|
| PubChem CID | 71658869 |
| Molecular Formula | C11H18N2O5S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1,2,3-trimethoxy-5-[2-(sulfamoylamino)ethyl]benzene |
| SMILES | COc1cc(CCNS(N)(=O)=O)cc(OC)c1OC |
| InChI | InChI=1S/C11H18N2O5S/c1-16-9-6-8(4-5-13-19(12,14)15)7-10(17-2)11(9)18-3/h6-7,13H,4-5H2,1-3H3,(H2,12,14,15) |
| InChIKey | XURRVLONLNFQSB-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |