C12H20N2O5S — CID 35313454
5-[(dimethylsulfamoylamino)methyl]-1,2,3-trimethoxybenzene (PubChem CID 35313454) has the molecular formula C12H20N2O5S and a molecular weight of 304.37 g/mol. Its IUPAC name is 5-[(dimethylsulfamoylamino)methyl]-1,2,3-trimethoxybenzene.
| Compound Name | 5-[(dimethylsulfamoylamino)methyl]-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 35313454 |
| Molecular Formula | C12H20N2O5S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 5-[(dimethylsulfamoylamino)methyl]-1,2,3-trimethoxybenzene |
| SMILES | COc1cc(CNS(=O)(=O)N(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C12H20N2O5S/c1-14(2)20(15,16)13-8-9-6-10(17-3)12(19-5)11(7-9)18-4/h6-7,13H,8H2,1-5H3 |
| InChIKey | OTOHTLLZWZKGES-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |