C17H21NO6S — CID 137451062
[3-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl] sulfamate (PubChem CID 137451062) has the molecular formula C17H21NO6S and a molecular weight of 367.42 g/mol. Its IUPAC name is [3-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl] sulfamate.
| Compound Name | [3-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl] sulfamate |
|---|---|
| PubChem CID | 137451062 |
| Molecular Formula | C17H21NO6S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | [3-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl] sulfamate |
| SMILES | COc1cc(CCc2cccc(OS(N)(=O)=O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C17H21NO6S/c1-21-15-10-13(11-16(22-2)17(15)23-3)8-7-12-5-4-6-14(9-12)24-25(18,19)20/h4-6,9-11H,7-8H2,1-3H3,(H2,18,19,20) |
| InChIKey | VXZBNPBWLFQKGD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |