C18H21F2NO7S — CID 137451145
[2-(difluoromethoxy)-5-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl] sulfamate (PubChem CID 137451145) has the molecular formula C18H21F2NO7S and a molecular weight of 433.43 g/mol. Its IUPAC name is [2-(difluoromethoxy)-5-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl] sulfamate.
| Compound Name | [2-(difluoromethoxy)-5-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl] sulfamate |
|---|---|
| PubChem CID | 137451145 |
| Molecular Formula | C18H21F2NO7S |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | [2-(difluoromethoxy)-5-[2-(3,4,5-trimethoxyphenyl)ethyl]phenyl] sulfamate |
| SMILES | COc1cc(CCc2ccc(OC(F)F)c(OS(N)(=O)=O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C18H21F2NO7S/c1-24-15-9-12(10-16(25-2)17(15)26-3)5-4-11-6-7-13(27-18(19)20)14(8-11)28-29(21,22)23/h6-10,18H,4-5H2,1-3H3,(H2,21,22,23) |
| InChIKey | CBCONBPGXQTDFC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |