C16H18F2N2O6S2 — CID 56578966
4-[[4-(difluoromethoxy)-3-methoxyphenyl]methylamino]-3-methylsulfonylbenzenesulfonamide (PubChem CID 56578966) has the molecular formula C16H18F2N2O6S2 and a molecular weight of 436.46 g/mol. Its IUPAC name is 4-[[4-(difluoromethoxy)-3-methoxyphenyl]methylamino]-3-methylsulfonylbenzenesulfonamide.
| Compound Name | 4-[[4-(difluoromethoxy)-3-methoxyphenyl]methylamino]-3-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 56578966 |
| Molecular Formula | C16H18F2N2O6S2 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 4-[[4-(difluoromethoxy)-3-methoxyphenyl]methylamino]-3-methylsulfonylbenzenesulfonamide |
| SMILES | COc1cc(CNc2ccc(S(N)(=O)=O)cc2S(C)(=O)=O)ccc1OC(F)F |
| InChI | InChI=1S/C16H18F2N2O6S2/c1-25-14-7-10(3-6-13(14)26-16(17)18)9-20-12-5-4-11(28(19,23)24)8-15(12)27(2,21)22/h3-8,16,20H,9H2,1-2H3,(H2,19,23,24) |
| InChIKey | PRMSHPHOUSXGHC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |