C17H19F2N3O5 — CID 24541383
2-[2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylamino]-4-nitroanilino]ethanol (PubChem CID 24541383) has the molecular formula C17H19F2N3O5 and a molecular weight of 383.35 g/mol. Its IUPAC name is 2-[2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylamino]-4-nitroanilino]ethanol.
| Compound Name | 2-[2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylamino]-4-nitroanilino]ethanol |
|---|---|
| PubChem CID | 24541383 |
| Molecular Formula | C17H19F2N3O5 |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-[2-[[4-(difluoromethoxy)-3-methoxyphenyl]methylamino]-4-nitroanilino]ethanol |
| SMILES | COc1cc(CNc2cc([N+](=O)[O-])ccc2NCCO)ccc1OC(F)F |
| InChI | InChI=1S/C17H19F2N3O5/c1-26-16-8-11(2-5-15(16)27-17(18)19)10-21-14-9-12(22(24)25)3-4-13(14)20-6-7-23/h2-5,8-9,17,20-21,23H,6-7,10H2,1H3 |
| InChIKey | RHXHXAQGNRJXQQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|