C18H19N5O5 — CID 30147688
2-[2-[[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methylamino]-4-nitroanilino]ethanol (PubChem CID 30147688) has the molecular formula C18H19N5O5 and a molecular weight of 385.38 g/mol. Its IUPAC name is 2-[2-[[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methylamino]-4-nitroanilino]ethanol.
| Compound Name | 2-[2-[[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methylamino]-4-nitroanilino]ethanol |
|---|---|
| PubChem CID | 30147688 |
| Molecular Formula | C18H19N5O5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-[2-[[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methylamino]-4-nitroanilino]ethanol |
| SMILES | COc1ccccc1-c1noc(CNc2cc([N+](=O)[O-])ccc2NCCO)n1 |
| InChI | InChI=1S/C18H19N5O5/c1-27-16-5-3-2-4-13(16)18-21-17(28-22-18)11-20-15-10-12(23(25)26)6-7-14(15)19-8-9-24/h2-7,10,19-20,24H,8-9,11H2,1H3 |
| InChIKey | WJDQVCORKYAVNJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|