C19H18N4O6 — CID 17344201
N-(2-methoxy-5-nitrophenyl)-3-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanamide (PubChem CID 17344201) has the molecular formula C19H18N4O6 and a molecular weight of 398.38 g/mol. Its IUPAC name is N-(2-methoxy-5-nitrophenyl)-3-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanamide.
| Compound Name | N-(2-methoxy-5-nitrophenyl)-3-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanamide |
|---|---|
| PubChem CID | 17344201 |
| Molecular Formula | C19H18N4O6 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N-(2-methoxy-5-nitrophenyl)-3-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)CCc1nc(-c2ccccc2OC)no1 |
| InChI | InChI=1S/C19H18N4O6/c1-27-15-6-4-3-5-13(15)19-21-18(29-22-19)10-9-17(24)20-14-11-12(23(25)26)7-8-16(14)28-2/h3-8,11H,9-10H2,1-2H3,(H,20,24) |
| InChIKey | XPUIVXPITRZVNH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|