About 2-[2-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methylamino]-4-nitroanilino]ethanol
2-[2-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methylamino]-4-nitroanilino]ethanol (PubChem CID 111702016) has the molecular formula C14H17N5O4
and a molecular weight of 319.32 g/mol. Its IUPAC name is 2-[2-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methylamino]-4-nitroanilino]ethanol.
Molecular Properties
| Compound Name | 2-[2-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methylamino]-4-nitroanilino]ethanol |
| PubChem CID | 111702016 |
| Molecular Formula | C14H17N5O4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 2-[2-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methylamino]-4-nitroanilino]ethanol |
| SMILES | O=[N+]([O-])c1ccc(NCCO)c(NCc2noc(C3CC3)n2)c1 |
| InChI | InChI=1S/C14H17N5O4/c20-6-5-15-11-4-3-10(19(21)22)7-12(11)16-8-13-17-14(23-18-13)9-1-2-9/h3-4,7,9,15-16,20H,1-2,5-6,8H2 |
| InChIKey | FHSALICRRYMQBM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methylamino]-4-nitroanilino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methylamino]-4-nitroanilino]ethanol?
The IUPAC name of 2-[2-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methylamino]-4-nitroanilino]ethanol (CID 111702016) is 2-[2-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methylamino]-4-nitroanilino]ethanol.
What is the SMILES notation for 2-[2-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methylamino]-4-nitroanilino]ethanol?
The canonical SMILES for 2-[2-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methylamino]-4-nitroanilino]ethanol is O=[N+]([O-])c1ccc(NCCO)c(NCc2noc(C3CC3)n2)c1.
What is the InChIKey of 2-[2-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methylamino]-4-nitroanilino]ethanol?
The InChIKey is FHSALICRRYMQBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5O4/c20-6-5-15-11-4-3-10(19(21)22)7-12(11)16-8-13-17-14(23-18-13)9-1-2-9/h3-4,7,9,15-16,20H,1-2,5-6,8H2.
What are the key properties of 2-[2-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methylamino]-4-nitroanilino]ethanol?
2-[2-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methylamino]-4-nitroanilino]ethanol has a molecular weight of 319.32 g/mol, XLogP of 1.87, 8 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methylamino]-4-nitroanilino]ethanol is sourced from PubChem (CID 111702016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).