C17H16N4O5 — CID 51224596
N-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-nitroaniline (PubChem CID 51224596) has the molecular formula C17H16N4O5 and a molecular weight of 356.34 g/mol. Its IUPAC name is N-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-nitroaniline.
| Compound Name | N-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-nitroaniline |
|---|---|
| PubChem CID | 51224596 |
| Molecular Formula | C17H16N4O5 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-nitroaniline |
| SMILES | COc1ccc(-c2noc(CNc3cccc([N+](=O)[O-])c3)n2)cc1OC |
| InChI | InChI=1S/C17H16N4O5/c1-24-14-7-6-11(8-15(14)25-2)17-19-16(26-20-17)10-18-12-4-3-5-13(9-12)21(22)23/h3-9,18H,10H2,1-2H3 |
| InChIKey | DAZAPGJGYFUOSR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|