C22H16N4O3 — CID 60535421
N-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]-9H-fluoren-2-amine (PubChem CID 60535421) has the molecular formula C22H16N4O3 and a molecular weight of 384.40 g/mol. Its IUPAC name is N-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]-9H-fluoren-2-amine.
| Compound Name | N-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]-9H-fluoren-2-amine |
|---|---|
| PubChem CID | 60535421 |
| Molecular Formula | C22H16N4O3 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | N-[[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]methyl]-9H-fluoren-2-amine |
| SMILES | O=[N+]([O-])c1cccc(-c2noc(CNc3ccc4c(c3)Cc3ccccc3-4)n2)c1 |
| InChI | InChI=1S/C22H16N4O3/c27-26(28)18-6-3-5-15(12-18)22-24-21(29-25-22)13-23-17-8-9-20-16(11-17)10-14-4-1-2-7-19(14)20/h1-9,11-12,23H,10,13H2 |
| InChIKey | VUTFVRDBNMKRJE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|