C16H13ClF2N2O5 — CID 9193851
2-chloro-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-4-nitrobenzamide (PubChem CID 9193851) has the molecular formula C16H13ClF2N2O5 and a molecular weight of 386.74 g/mol. Its IUPAC name is 2-chloro-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 9193851 |
| Molecular Formula | C16H13ClF2N2O5 |
| Molecular Weight | 386.74 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 2-chloro-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-4-nitrobenzamide |
| SMILES | COc1cc(CNC(=O)c2ccc([N+](=O)[O-])cc2Cl)ccc1OC(F)F |
| InChI | InChI=1S/C16H13ClF2N2O5/c1-25-14-6-9(2-5-13(14)26-16(18)19)8-20-15(22)11-4-3-10(21(23)24)7-12(11)17/h2-7,16H,8H2,1H3,(H,20,22) |
| InChIKey | RMEBNNZAOCTNHF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.74 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|