C18H19F3N4O5 — CID 22467557
N-[(3,4-dimethoxyphenyl)methyl]-5-nitro-2-[2-(2,2,2-trifluoroethyl)hydrazinyl]benzamide (PubChem CID 22467557) has the molecular formula C18H19F3N4O5 and a molecular weight of 428.37 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-5-nitro-2-[2-(2,2,2-trifluoroethyl)hydrazinyl]benzamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-5-nitro-2-[2-(2,2,2-trifluoroethyl)hydrazinyl]benzamide |
|---|---|
| PubChem CID | 22467557 |
| Molecular Formula | C18H19F3N4O5 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-5-nitro-2-[2-(2,2,2-trifluoroethyl)hydrazinyl]benzamide |
| SMILES | COc1ccc(CNC(=O)c2cc([N+](=O)[O-])ccc2NNCC(F)(F)F)cc1OC |
| InChI | InChI=1S/C18H19F3N4O5/c1-29-15-6-3-11(7-16(15)30-2)9-22-17(26)13-8-12(25(27)28)4-5-14(13)24-23-10-18(19,20)21/h3-8,23-24H,9-10H2,1-2H3,(H,22,26) |
| InChIKey | LDXYGULHMAGRJK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|