C25H32N4O7 — CID 22467482
N-[(3,4-dimethoxyphenyl)methyl]-2-[[4-(2-hydroxyethylcarbamoyl)cyclohexyl]amino]-5-nitrobenzamide (PubChem CID 22467482) has the molecular formula C25H32N4O7 and a molecular weight of 500.55 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-[[4-(2-hydroxyethylcarbamoyl)cyclohexyl]amino]-5-nitrobenzamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-[[4-(2-hydroxyethylcarbamoyl)cyclohexyl]amino]-5-nitrobenzamide |
|---|---|
| PubChem CID | 22467482 |
| Molecular Formula | C25H32N4O7 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-[[4-(2-hydroxyethylcarbamoyl)cyclohexyl]amino]-5-nitrobenzamide |
| SMILES | COc1ccc(CNC(=O)c2cc([N+](=O)[O-])ccc2NC2CCC(C(=O)NCCO)CC2)cc1OC |
| InChI | InChI=1S/C25H32N4O7/c1-35-22-10-3-16(13-23(22)36-2)15-27-25(32)20-14-19(29(33)34)8-9-21(20)28-18-6-4-17(5-7-18)24(31)26-11-12-30/h3,8-10,13-14,17-18,28,30H,4-7,11-12,15H2,1-2H3,(H,26,31)(H,27,32) |
| InChIKey | JXDLECMOLNEWFQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 152.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|