C24H30N4O6 — CID 70077651
2-[acetamido(cyclohexyl)amino]-N-[(3,4-dimethoxyphenyl)methyl]-5-nitrobenzamide (PubChem CID 70077651) has the molecular formula C24H30N4O6 and a molecular weight of 470.53 g/mol. Its IUPAC name is 2-[acetamido(cyclohexyl)amino]-N-[(3,4-dimethoxyphenyl)methyl]-5-nitrobenzamide.
| Compound Name | 2-[acetamido(cyclohexyl)amino]-N-[(3,4-dimethoxyphenyl)methyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 70077651 |
| Molecular Formula | C24H30N4O6 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 2-[acetamido(cyclohexyl)amino]-N-[(3,4-dimethoxyphenyl)methyl]-5-nitrobenzamide |
| SMILES | COc1ccc(CNC(=O)c2cc([N+](=O)[O-])ccc2N(NC(C)=O)C2CCCCC2)cc1OC |
| InChI | InChI=1S/C24H30N4O6/c1-16(29)26-27(18-7-5-4-6-8-18)21-11-10-19(28(31)32)14-20(21)24(30)25-15-17-9-12-22(33-2)23(13-17)34-3/h9-14,18H,4-8,15H2,1-3H3,(H,25,30)(H,26,29) |
| InChIKey | QDXAXPIMNFTHAW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|