C33H46N6O9 — CID 173231608
tert-butyl N-[4-[2-[(3,4-dimethoxyphenyl)methylcarbamoyl]-4-nitroanilino]cyclohexyl]-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 173231608) has the molecular formula C33H46N6O9 and a molecular weight of 670.76 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[(3,4-dimethoxyphenyl)methylcarbamoyl]-4-nitroanilino]cyclohexyl]-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[(3,4-dimethoxyphenyl)methylcarbamoyl]-4-nitroanilino]cyclohexyl]-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 173231608 |
| Molecular Formula | C33H46N6O9 |
| Molecular Weight | 670.76 g/mol |
| Exact Mass | 670.33 |
| IUPAC Name | tert-butyl N-[4-[2-[(3,4-dimethoxyphenyl)methylcarbamoyl]-4-nitroanilino]cyclohexyl]-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C1CCC(Nc2ccc([N+](=O)[O-])cc2C(=O)NCc2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C33H46N6O9/c1-32(2,3)47-30(41)37-29(34)38(31(42)48-33(4,5)6)22-12-10-21(11-13-22)36-25-15-14-23(39(43)44)18-24(25)28(40)35-19-20-9-16-26(45-7)27(17-20)46-8/h9,14-18,21-22,36H,10-13,19H2,1-8H3,(H,35,40)(H2,34,37,41) |
| InChIKey | STRDNJINLNUWCD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 194.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.76 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|