C23H23N3O3 — CID 70067874
2-(cyclopentylamino)-N-(naphthalen-1-ylmethyl)-5-nitrobenzamide (PubChem CID 70067874) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-(cyclopentylamino)-N-(naphthalen-1-ylmethyl)-5-nitrobenzamide.
| Compound Name | 2-(cyclopentylamino)-N-(naphthalen-1-ylmethyl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 70067874 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 2-(cyclopentylamino)-N-(naphthalen-1-ylmethyl)-5-nitrobenzamide |
| SMILES | O=C(NCc1cccc2ccccc12)c1cc([N+](=O)[O-])ccc1NC1CCCC1 |
| InChI | InChI=1S/C23H23N3O3/c27-23(24-15-17-8-5-7-16-6-1-4-11-20(16)17)21-14-19(26(28)29)12-13-22(21)25-18-9-2-3-10-18/h1,4-8,11-14,18,25H,2-3,9-10,15H2,(H,24,27) |
| InChIKey | BKSOHVZSOMXJBK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|