C22H23N3O4S — CID 22467406
N-(1-benzothiophen-2-ylmethyl)-2-[(4-hydroxycyclohexyl)amino]-5-nitrobenzamide (PubChem CID 22467406) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is N-(1-benzothiophen-2-ylmethyl)-2-[(4-hydroxycyclohexyl)amino]-5-nitrobenzamide.
| Compound Name | N-(1-benzothiophen-2-ylmethyl)-2-[(4-hydroxycyclohexyl)amino]-5-nitrobenzamide |
|---|---|
| PubChem CID | 22467406 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-(1-benzothiophen-2-ylmethyl)-2-[(4-hydroxycyclohexyl)amino]-5-nitrobenzamide |
| SMILES | O=C(NCc1cc2ccccc2s1)c1cc([N+](=O)[O-])ccc1NC1CCC(O)CC1 |
| InChI | InChI=1S/C22H23N3O4S/c26-17-8-5-15(6-9-17)24-20-10-7-16(25(28)29)12-19(20)22(27)23-13-18-11-14-3-1-2-4-21(14)30-18/h1-4,7,10-12,15,17,24,26H,5-6,8-9,13H2,(H,23,27) |
| InChIKey | JNWVTLYKWOKENV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|