C17H16N4O3S2 — CID 24532528
2-(methylamino)-N-[[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]methyl]-5-nitrobenzamide (PubChem CID 24532528) has the molecular formula C17H16N4O3S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-(methylamino)-N-[[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]methyl]-5-nitrobenzamide.
| Compound Name | 2-(methylamino)-N-[[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]methyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 24532528 |
| Molecular Formula | C17H16N4O3S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 2-(methylamino)-N-[[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]methyl]-5-nitrobenzamide |
| SMILES | CNc1ccc([N+](=O)[O-])cc1C(=O)NCc1ccc(-c2csc(C)n2)s1 |
| InChI | InChI=1S/C17H16N4O3S2/c1-10-20-15(9-25-10)16-6-4-12(26-16)8-19-17(22)13-7-11(21(23)24)3-5-14(13)18-2/h3-7,9,18H,8H2,1-2H3,(H,19,22) |
| InChIKey | LMUWFXNOWMCSEV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|