C19H22F2N2O4S — CID 24674203
N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-pyrrolidin-1-ylsulfonylaniline (PubChem CID 24674203) has the molecular formula C19H22F2N2O4S and a molecular weight of 412.46 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-pyrrolidin-1-ylsulfonylaniline.
| Compound Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-pyrrolidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 24674203 |
| Molecular Formula | C19H22F2N2O4S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-pyrrolidin-1-ylsulfonylaniline |
| SMILES | COc1cc(CNc2cccc(S(=O)(=O)N3CCCC3)c2)ccc1OC(F)F |
| InChI | InChI=1S/C19H22F2N2O4S/c1-26-18-11-14(7-8-17(18)27-19(20)21)13-22-15-5-4-6-16(12-15)28(24,25)23-9-2-3-10-23/h4-8,11-12,19,22H,2-3,9-10,13H2,1H3 |
| InChIKey | TXSBHWJKSRUHKI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |