C22H24F2N2O5S — CID 3646487
3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(3-piperidin-1-ylsulfonylphenyl)prop-2-enamide (PubChem CID 3646487) has the molecular formula C22H24F2N2O5S and a molecular weight of 466.51 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(3-piperidin-1-ylsulfonylphenyl)prop-2-enamide.
| Compound Name | 3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(3-piperidin-1-ylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3646487 |
| Molecular Formula | C22H24F2N2O5S |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(3-piperidin-1-ylsulfonylphenyl)prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2cccc(S(=O)(=O)N3CCCCC3)c2)ccc1OC(F)F |
| InChI | InChI=1S/C22H24F2N2O5S/c1-30-20-14-16(8-10-19(20)31-22(23)24)9-11-21(27)25-17-6-5-7-18(15-17)32(28,29)26-12-3-2-4-13-26/h5-11,14-15,22H,2-4,12-13H2,1H3,(H,25,27) |
| InChIKey | NLWJBZWCYGIJTJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|