C20H22F2N2O5S — CID 26252591
4-(difluoromethoxy)-3-methoxy-N-(4-piperidin-1-ylsulfonylphenyl)benzamide (PubChem CID 26252591) has the molecular formula C20H22F2N2O5S and a molecular weight of 440.47 g/mol. Its IUPAC name is 4-(difluoromethoxy)-3-methoxy-N-(4-piperidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 4-(difluoromethoxy)-3-methoxy-N-(4-piperidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 26252591 |
| Molecular Formula | C20H22F2N2O5S |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 4-(difluoromethoxy)-3-methoxy-N-(4-piperidin-1-ylsulfonylphenyl)benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C20H22F2N2O5S/c1-28-18-13-14(5-10-17(18)29-20(21)22)19(25)23-15-6-8-16(9-7-15)30(26,27)24-11-3-2-4-12-24/h5-10,13,20H,2-4,11-12H2,1H3,(H,23,25) |
| InChIKey | JUAHXLYPSAENGL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |