C15H17F2N3O5S — CID 55564863
4-[[4-(difluoromethoxy)-3-methoxyphenyl]methylsulfamoyl]-1-methylpyrrole-2-carboxamide (PubChem CID 55564863) has the molecular formula C15H17F2N3O5S and a molecular weight of 389.38 g/mol. Its IUPAC name is 4-[[4-(difluoromethoxy)-3-methoxyphenyl]methylsulfamoyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[[4-(difluoromethoxy)-3-methoxyphenyl]methylsulfamoyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 55564863 |
| Molecular Formula | C15H17F2N3O5S |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 4-[[4-(difluoromethoxy)-3-methoxyphenyl]methylsulfamoyl]-1-methylpyrrole-2-carboxamide |
| SMILES | COc1cc(CNS(=O)(=O)c2cc(C(N)=O)n(C)c2)ccc1OC(F)F |
| InChI | InChI=1S/C15H17F2N3O5S/c1-20-8-10(6-11(20)14(18)21)26(22,23)19-7-9-3-4-12(25-15(16)17)13(5-9)24-2/h3-6,8,15,19H,7H2,1-2H3,(H2,18,21) |
| InChIKey | YREATROJOYTSKU-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |