C11H14ClF2NO — CID 107477800
2-[2-(2-chloro-4,5-difluorophenyl)ethoxy]-N-methylethanamine (PubChem CID 107477800) has the molecular formula C11H14ClF2NO and a molecular weight of 249.69 g/mol. Its IUPAC name is 2-[2-(2-chloro-4,5-difluorophenyl)ethoxy]-N-methylethanamine.
| Compound Name | 2-[2-(2-chloro-4,5-difluorophenyl)ethoxy]-N-methylethanamine |
|---|---|
| PubChem CID | 107477800 |
| Molecular Formula | C11H14ClF2NO |
| Molecular Weight | 249.69 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-[2-(2-chloro-4,5-difluorophenyl)ethoxy]-N-methylethanamine |
| SMILES | CNCCOCCc1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C11H14ClF2NO/c1-15-3-5-16-4-2-8-6-10(13)11(14)7-9(8)12/h6-7,15H,2-5H2,1H3 |
| InChIKey | LPCNQGIDSUPMAB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.69 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|