About 2-[2-(2,4,5-trifluorophenyl)ethoxy]ethanamine
2-[2-(2,4,5-trifluorophenyl)ethoxy]ethanamine (PubChem CID 103304871) has the molecular formula C10H12F3NO
and a molecular weight of 219.21 g/mol. Its IUPAC name is 2-[2-(2,4,5-trifluorophenyl)ethoxy]ethanamine.
Molecular Properties
| Compound Name | 2-[2-(2,4,5-trifluorophenyl)ethoxy]ethanamine |
| PubChem CID | 103304871 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-[2-(2,4,5-trifluorophenyl)ethoxy]ethanamine |
| SMILES | NCCOCCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C10H12F3NO/c11-8-6-10(13)9(12)5-7(8)1-3-15-4-2-14/h5-6H,1-4,14H2 |
| InChIKey | VALWWVAHPAJQMX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,4,5-trifluorophenyl)ethoxy]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,4,5-trifluorophenyl)ethoxy]ethanamine?
The IUPAC name of 2-[2-(2,4,5-trifluorophenyl)ethoxy]ethanamine (CID 103304871) is 2-[2-(2,4,5-trifluorophenyl)ethoxy]ethanamine.
What is the SMILES notation for 2-[2-(2,4,5-trifluorophenyl)ethoxy]ethanamine?
The canonical SMILES for 2-[2-(2,4,5-trifluorophenyl)ethoxy]ethanamine is NCCOCCc1cc(F)c(F)cc1F.
What is the InChIKey of 2-[2-(2,4,5-trifluorophenyl)ethoxy]ethanamine?
The InChIKey is VALWWVAHPAJQMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F3NO/c11-8-6-10(13)9(12)5-7(8)1-3-15-4-2-14/h5-6H,1-4,14H2.
What are the key properties of 2-[2-(2,4,5-trifluorophenyl)ethoxy]ethanamine?
2-[2-(2,4,5-trifluorophenyl)ethoxy]ethanamine has a molecular weight of 219.21 g/mol, XLogP of 1.62, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,4,5-trifluorophenyl)ethoxy]ethanamine is sourced from PubChem (CID 103304871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).