C12H18BrNO — CID 65305826
2-[2-(4-bromo-2,5-dimethylphenyl)ethoxy]ethanamine (PubChem CID 65305826) has the molecular formula C12H18BrNO and a molecular weight of 272.19 g/mol. Its IUPAC name is 2-[2-(4-bromo-2,5-dimethylphenyl)ethoxy]ethanamine.
| Compound Name | 2-[2-(4-bromo-2,5-dimethylphenyl)ethoxy]ethanamine |
|---|---|
| PubChem CID | 65305826 |
| Molecular Formula | C12H18BrNO |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-[2-(4-bromo-2,5-dimethylphenyl)ethoxy]ethanamine |
| SMILES | Cc1cc(CCOCCN)c(C)cc1Br |
| InChI | InChI=1S/C12H18BrNO/c1-9-8-12(13)10(2)7-11(9)3-5-15-6-4-14/h7-8H,3-6,14H2,1-2H3 |
| InChIKey | FPGMYAWXFIUURR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|