About 2-[2-(4-bromo-2,5-dimethylphenyl)ethoxy]ethanamine
2-[2-(4-bromo-2,5-dimethylphenyl)ethoxy]ethanamine (PubChem CID 65305826) has the molecular formula C12H18BrNO
and a molecular weight of 272.19 g/mol. Its IUPAC name is 2-[2-(4-bromo-2,5-dimethylphenyl)ethoxy]ethanamine.
Molecular Properties
| Compound Name | 2-[2-(4-bromo-2,5-dimethylphenyl)ethoxy]ethanamine |
| PubChem CID | 65305826 |
| Molecular Formula | C12H18BrNO |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-[2-(4-bromo-2,5-dimethylphenyl)ethoxy]ethanamine |
| SMILES | Cc1cc(CCOCCN)c(C)cc1Br |
| InChI | InChI=1S/C12H18BrNO/c1-9-8-12(13)10(2)7-11(9)3-5-15-6-4-14/h7-8H,3-6,14H2,1-2H3 |
| InChIKey | FPGMYAWXFIUURR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(4-bromo-2,5-dimethylphenyl)ethoxy]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-bromo-2,5-dimethylphenyl)ethoxy]ethanamine?
The IUPAC name of 2-[2-(4-bromo-2,5-dimethylphenyl)ethoxy]ethanamine (CID 65305826) is 2-[2-(4-bromo-2,5-dimethylphenyl)ethoxy]ethanamine.
What is the SMILES notation for 2-[2-(4-bromo-2,5-dimethylphenyl)ethoxy]ethanamine?
The canonical SMILES for 2-[2-(4-bromo-2,5-dimethylphenyl)ethoxy]ethanamine is Cc1cc(CCOCCN)c(C)cc1Br.
What is the InChIKey of 2-[2-(4-bromo-2,5-dimethylphenyl)ethoxy]ethanamine?
The InChIKey is FPGMYAWXFIUURR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18BrNO/c1-9-8-12(13)10(2)7-11(9)3-5-15-6-4-14/h7-8H,3-6,14H2,1-2H3.
What are the key properties of 2-[2-(4-bromo-2,5-dimethylphenyl)ethoxy]ethanamine?
2-[2-(4-bromo-2,5-dimethylphenyl)ethoxy]ethanamine has a molecular weight of 272.19 g/mol, XLogP of 2.58, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-bromo-2,5-dimethylphenyl)ethoxy]ethanamine is sourced from PubChem (CID 65305826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).