C14H20F3N — CID 175548510
2,2-dimethyl-6-(2,4,5-trifluorophenyl)hexan-1-amine (PubChem CID 175548510) has the molecular formula C14H20F3N and a molecular weight of 259.31 g/mol. Its IUPAC name is 2,2-dimethyl-6-(2,4,5-trifluorophenyl)hexan-1-amine.
| Compound Name | 2,2-dimethyl-6-(2,4,5-trifluorophenyl)hexan-1-amine |
|---|---|
| PubChem CID | 175548510 |
| Molecular Formula | C14H20F3N |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 2,2-dimethyl-6-(2,4,5-trifluorophenyl)hexan-1-amine |
| SMILES | CC(C)(CN)CCCCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C14H20F3N/c1-14(2,9-18)6-4-3-5-10-7-12(16)13(17)8-11(10)15/h7-8H,3-6,9,18H2,1-2H3 |
| InChIKey | XATLKDBAUFRCOL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|