About 6-(3,4-difluorophenyl)sulfinyl-2,2-dimethylhexan-1-amine
6-(3,4-difluorophenyl)sulfinyl-2,2-dimethylhexan-1-amine (PubChem CID 106714797) has the molecular formula C14H21F2NOS
and a molecular weight of 289.39 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)sulfinyl-2,2-dimethylhexan-1-amine.
Molecular Properties
| Compound Name | 6-(3,4-difluorophenyl)sulfinyl-2,2-dimethylhexan-1-amine |
| PubChem CID | 106714797 |
| Molecular Formula | C14H21F2NOS |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 6-(3,4-difluorophenyl)sulfinyl-2,2-dimethylhexan-1-amine |
| SMILES | CC(C)(CN)CCCCS(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H21F2NOS/c1-14(2,10-17)7-3-4-8-19(18)11-5-6-12(15)13(16)9-11/h5-6,9H,3-4,7-8,10,17H2,1-2H3 |
| InChIKey | DLSAHPMCBAOPRO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(3,4-difluorophenyl)sulfinyl-2,2-dimethylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4-difluorophenyl)sulfinyl-2,2-dimethylhexan-1-amine?
The IUPAC name of 6-(3,4-difluorophenyl)sulfinyl-2,2-dimethylhexan-1-amine (CID 106714797) is 6-(3,4-difluorophenyl)sulfinyl-2,2-dimethylhexan-1-amine.
What is the SMILES notation for 6-(3,4-difluorophenyl)sulfinyl-2,2-dimethylhexan-1-amine?
The canonical SMILES for 6-(3,4-difluorophenyl)sulfinyl-2,2-dimethylhexan-1-amine is CC(C)(CN)CCCCS(=O)c1ccc(F)c(F)c1.
What is the InChIKey of 6-(3,4-difluorophenyl)sulfinyl-2,2-dimethylhexan-1-amine?
The InChIKey is DLSAHPMCBAOPRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21F2NOS/c1-14(2,10-17)7-3-4-8-19(18)11-5-6-12(15)13(16)9-11/h5-6,9H,3-4,7-8,10,17H2,1-2H3.
What are the key properties of 6-(3,4-difluorophenyl)sulfinyl-2,2-dimethylhexan-1-amine?
6-(3,4-difluorophenyl)sulfinyl-2,2-dimethylhexan-1-amine has a molecular weight of 289.39 g/mol, XLogP of 3.23, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-difluorophenyl)sulfinyl-2,2-dimethylhexan-1-amine is sourced from PubChem (CID 106714797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).