C13H21NO2S — CID 81329116
4-(4-methoxyphenyl)sulfinyl-2,2-dimethylbutan-1-amine (PubChem CID 81329116) has the molecular formula C13H21NO2S and a molecular weight of 255.38 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)sulfinyl-2,2-dimethylbutan-1-amine.
| Compound Name | 4-(4-methoxyphenyl)sulfinyl-2,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 81329116 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 4-(4-methoxyphenyl)sulfinyl-2,2-dimethylbutan-1-amine |
| SMILES | COc1ccc(S(=O)CCC(C)(C)CN)cc1 |
| InChI | InChI=1S/C13H21NO2S/c1-13(2,10-14)8-9-17(15)12-6-4-11(16-3)5-7-12/h4-7H,8-10,14H2,1-3H3 |
| InChIKey | XXFFHDLJWJKFOH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |