About hydroxylamine;7-[(S)-(4-methoxyphenyl)sulfinyl]heptanoic acid
hydroxylamine;7-[(S)-(4-methoxyphenyl)sulfinyl]heptanoic acid (PubChem CID 70154736) has the molecular formula C14H23NO5S
and a molecular weight of 317.41 g/mol. Its IUPAC name is hydroxylamine;7-[(S)-(4-methoxyphenyl)sulfinyl]heptanoic acid.
Molecular Properties
| Compound Name | hydroxylamine;7-[(S)-(4-methoxyphenyl)sulfinyl]heptanoic acid |
| PubChem CID | 70154736 |
| Molecular Formula | C14H23NO5S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | hydroxylamine;7-[(S)-(4-methoxyphenyl)sulfinyl]heptanoic acid |
| SMILES | COc1ccc([S@@](=O)CCCCCCC(=O)O)cc1.NO |
| InChI | InChI=1S/C14H20O4S.H3NO/c1-18-12-7-9-13(10-8-12)19(17)11-5-3-2-4-6-14(15)16;1-2/h7-10H,2-6,11H2,1H3,(H,15,16);2H,1H2/t19-;/m0./s1 |
| InChIKey | FVFWNTWUIWNBQS-FYZYNONXSA-N |
| XLogP | 2.17 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydroxylamine;7-[(S)-(4-methoxyphenyl)sulfinyl]heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxylamine;7-[(S)-(4-methoxyphenyl)sulfinyl]heptanoic acid?
The IUPAC name of hydroxylamine;7-[(S)-(4-methoxyphenyl)sulfinyl]heptanoic acid (CID 70154736) is hydroxylamine;7-[(S)-(4-methoxyphenyl)sulfinyl]heptanoic acid.
What is the SMILES notation for hydroxylamine;7-[(S)-(4-methoxyphenyl)sulfinyl]heptanoic acid?
The canonical SMILES for hydroxylamine;7-[(S)-(4-methoxyphenyl)sulfinyl]heptanoic acid is COc1ccc([S@@](=O)CCCCCCC(=O)O)cc1.NO.
What is the InChIKey of hydroxylamine;7-[(S)-(4-methoxyphenyl)sulfinyl]heptanoic acid?
The InChIKey is FVFWNTWUIWNBQS-FYZYNONXSA-N. The full InChI is InChI=1S/C14H20O4S.H3NO/c1-18-12-7-9-13(10-8-12)19(17)11-5-3-2-4-6-14(15)16;1-2/h7-10H,2-6,11H2,1H3,(H,15,16);2H,1H2/t19-;/m0./s1.
What are the key properties of hydroxylamine;7-[(S)-(4-methoxyphenyl)sulfinyl]heptanoic acid?
hydroxylamine;7-[(S)-(4-methoxyphenyl)sulfinyl]heptanoic acid has a molecular weight of 317.41 g/mol, XLogP of 2.17, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxylamine;7-[(S)-(4-methoxyphenyl)sulfinyl]heptanoic acid is sourced from PubChem (CID 70154736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).