C13H21NO3S2 — CID 81333896
2,2-dimethyl-4-(4-methylsulfonylphenyl)sulfinylbutan-1-amine (PubChem CID 81333896) has the molecular formula C13H21NO3S2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 2,2-dimethyl-4-(4-methylsulfonylphenyl)sulfinylbutan-1-amine.
| Compound Name | 2,2-dimethyl-4-(4-methylsulfonylphenyl)sulfinylbutan-1-amine |
|---|---|
| PubChem CID | 81333896 |
| Molecular Formula | C13H21NO3S2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2,2-dimethyl-4-(4-methylsulfonylphenyl)sulfinylbutan-1-amine |
| SMILES | CC(C)(CN)CCS(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H21NO3S2/c1-13(2,10-14)8-9-18(15)11-4-6-12(7-5-11)19(3,16)17/h4-7H,8-10,14H2,1-3H3 |
| InChIKey | DRYUERLWOXGTIR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |