C12H19NO4S2 — CID 81333630
2-ethoxy-3-(4-methylsulfonylphenyl)sulfinylpropan-1-amine (PubChem CID 81333630) has the molecular formula C12H19NO4S2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 2-ethoxy-3-(4-methylsulfonylphenyl)sulfinylpropan-1-amine.
| Compound Name | 2-ethoxy-3-(4-methylsulfonylphenyl)sulfinylpropan-1-amine |
|---|---|
| PubChem CID | 81333630 |
| Molecular Formula | C12H19NO4S2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2-ethoxy-3-(4-methylsulfonylphenyl)sulfinylpropan-1-amine |
| SMILES | CCOC(CN)CS(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H19NO4S2/c1-3-17-10(8-13)9-18(14)11-4-6-12(7-5-11)19(2,15)16/h4-7,10H,3,8-9,13H2,1-2H3 |
| InChIKey | MQEGQGKNCWEJMC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |