C12H17F2NO2S — CID 81328252
4-(3,4-difluorophenyl)sulfinyl-2-ethoxybutan-1-amine (PubChem CID 81328252) has the molecular formula C12H17F2NO2S and a molecular weight of 277.34 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)sulfinyl-2-ethoxybutan-1-amine.
| Compound Name | 4-(3,4-difluorophenyl)sulfinyl-2-ethoxybutan-1-amine |
|---|---|
| PubChem CID | 81328252 |
| Molecular Formula | C12H17F2NO2S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 4-(3,4-difluorophenyl)sulfinyl-2-ethoxybutan-1-amine |
| SMILES | CCOC(CN)CCS(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H17F2NO2S/c1-2-17-9(8-15)5-6-18(16)10-3-4-11(13)12(14)7-10/h3-4,7,9H,2,5-6,8,15H2,1H3 |
| InChIKey | DAXMCGKXEYUDMB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |