C12H17Cl2NO3S — CID 64696960
4-(2,5-dichlorophenyl)sulfonyl-2-ethoxybutan-1-amine (PubChem CID 64696960) has the molecular formula C12H17Cl2NO3S and a molecular weight of 326.25 g/mol. Its IUPAC name is 4-(2,5-dichlorophenyl)sulfonyl-2-ethoxybutan-1-amine.
| Compound Name | 4-(2,5-dichlorophenyl)sulfonyl-2-ethoxybutan-1-amine |
|---|---|
| PubChem CID | 64696960 |
| Molecular Formula | C12H17Cl2NO3S |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 4-(2,5-dichlorophenyl)sulfonyl-2-ethoxybutan-1-amine |
| SMILES | CCOC(CN)CCS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H17Cl2NO3S/c1-2-18-10(8-15)5-6-19(16,17)12-7-9(13)3-4-11(12)14/h3-4,7,10H,2,5-6,8,15H2,1H3 |
| InChIKey | IPRVTVDEEIHGAK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |