C15H14F2O2S — CID 99832944
1,2-difluoro-4-[(S)-2-(4-methoxyphenyl)ethylsulfinyl]benzene (PubChem CID 99832944) has the molecular formula C15H14F2O2S and a molecular weight of 296.34 g/mol. Its IUPAC name is 1,2-difluoro-4-[(S)-2-(4-methoxyphenyl)ethylsulfinyl]benzene.
| Compound Name | 1,2-difluoro-4-[(S)-2-(4-methoxyphenyl)ethylsulfinyl]benzene |
|---|---|
| PubChem CID | 99832944 |
| Molecular Formula | C15H14F2O2S |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 1,2-difluoro-4-[(S)-2-(4-methoxyphenyl)ethylsulfinyl]benzene |
| SMILES | COc1ccc(CC[S@](=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C15H14F2O2S/c1-19-12-4-2-11(3-5-12)8-9-20(18)13-6-7-14(16)15(17)10-13/h2-7,10H,8-9H2,1H3/t20-/m0/s1 |
| InChIKey | GFMHMBLJHRBVND-FQEVSTJZSA-N |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |