C16H13F3O2S — CID 11472839
1,2,4-trifluoro-5-[(E)-2-[(4-methoxyphenyl)methylsulfinyl]ethenyl]benzene (PubChem CID 11472839) has the molecular formula C16H13F3O2S and a molecular weight of 326.34 g/mol. Its IUPAC name is 1,2,4-trifluoro-5-[(E)-2-[(4-methoxyphenyl)methylsulfinyl]ethenyl]benzene.
| Compound Name | 1,2,4-trifluoro-5-[(E)-2-[(4-methoxyphenyl)methylsulfinyl]ethenyl]benzene |
|---|---|
| PubChem CID | 11472839 |
| Molecular Formula | C16H13F3O2S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 1,2,4-trifluoro-5-[(E)-2-[(4-methoxyphenyl)methylsulfinyl]ethenyl]benzene |
| SMILES | COc1ccc(CS(=O)/C=C/c2cc(F)c(F)cc2F)cc1 |
| InChI | InChI=1S/C16H13F3O2S/c1-21-13-4-2-11(3-5-13)10-22(20)7-6-12-8-15(18)16(19)9-14(12)17/h2-9H,10H2,1H3/b7-6+ |
| InChIKey | BJNKRRLWCHDRBW-VOTSOKGWSA-N |
| XLogP | 4.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|