C20H21F3O8S2 — CID 87269860
[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfinylmethyl]phenyl] trifluoromethanesulfonate (PubChem CID 87269860) has the molecular formula C20H21F3O8S2 and a molecular weight of 510.51 g/mol. Its IUPAC name is [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfinylmethyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfinylmethyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87269860 |
| Molecular Formula | C20H21F3O8S2 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfinylmethyl]phenyl] trifluoromethanesulfonate |
| SMILES | COc1cc(OC)c(/C=C/S(=O)Cc2ccc(OC)c(OS(=O)(=O)C(F)(F)F)c2)c(OC)c1 |
| InChI | InChI=1S/C20H21F3O8S2/c1-27-14-10-17(29-3)15(18(11-14)30-4)7-8-32(24)12-13-5-6-16(28-2)19(9-13)31-33(25,26)20(21,22)23/h5-11H,12H2,1-4H3/b8-7+ |
| InChIKey | YDYKONHGEQLFCY-BQYQJAHWSA-N |
| XLogP | 3.87 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|